C15H25N3 — CID 142253116
2-benzyl-2,7-diazaspiro[4.4]nonane;methanamine (PubChem CID 142253116) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 2-benzyl-2,7-diazaspiro[4.4]nonane;methanamine.
| Compound Name | 2-benzyl-2,7-diazaspiro[4.4]nonane;methanamine |
|---|---|
| PubChem CID | 142253116 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 2-benzyl-2,7-diazaspiro[4.4]nonane;methanamine |
| SMILES | CN.c1ccc(CN2CCC3(CCNC3)C2)cc1 |
| InChI | InChI=1S/C14H20N2.CH5N/c1-2-4-13(5-3-1)10-16-9-7-14(12-16)6-8-15-11-14;1-2/h1-5,15H,6-12H2;2H2,1H3 |
| InChIKey | AGRAAUZNVNYUOX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |