C14H19FN2 — CID 82038611
2-[(3-fluorophenyl)methyl]-2,7-diazaspiro[4.4]nonane (PubChem CID 82038611) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-[(3-fluorophenyl)methyl]-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 82038611 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-2,7-diazaspiro[4.4]nonane |
| SMILES | Fc1cccc(CN2CCC3(CCNC3)C2)c1 |
| InChI | InChI=1S/C14H19FN2/c15-13-3-1-2-12(8-13)9-17-7-5-14(11-17)4-6-16-10-14/h1-3,8,16H,4-7,9-11H2 |
| InChIKey | UBTWKXLSWGPOTO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |