C16H23ClN2O2 — CID 120907762
methyl 3-(2,7-diazaspiro[4.4]nonan-2-ylmethyl)benzoate;hydrochloride (PubChem CID 120907762) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is methyl 3-(2,7-diazaspiro[4.4]nonan-2-ylmethyl)benzoate;hydrochloride.
| Compound Name | methyl 3-(2,7-diazaspiro[4.4]nonan-2-ylmethyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 120907762 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl 3-(2,7-diazaspiro[4.4]nonan-2-ylmethyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1cccc(CN2CCC3(CCNC3)C2)c1.Cl |
| InChI | InChI=1S/C16H22N2O2.ClH/c1-20-15(19)14-4-2-3-13(9-14)10-18-8-6-16(12-18)5-7-17-11-16;/h2-4,9,17H,5-8,10-12H2,1H3;1H |
| InChIKey | IZIFPVCMCVTONR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |