About 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride
2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride (PubChem CID 120908518) has the molecular formula C19H24ClN3
and a molecular weight of 329.88 g/mol. Its IUPAC name is 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride.
Molecular Properties
| Compound Name | 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride |
| PubChem CID | 120908518 |
| Molecular Formula | C19H24ClN3 |
| Molecular Weight | 329.88 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride |
| SMILES | Cl.c1ccc(-c2cccc(CN3CCC4(CCNC4)C3)c2)nc1 |
| InChI | InChI=1S/C19H23N3.ClH/c1-2-9-21-18(6-1)17-5-3-4-16(12-17)13-22-11-8-19(15-22)7-10-20-14-19;/h1-6,9,12,20H,7-8,10-11,13-15H2;1H |
| InChIKey | WZAOPAFMUJIXSN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The IUPAC name of 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride (CID 120908518) is 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride.
What is the SMILES notation for 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The canonical SMILES for 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride is Cl.c1ccc(-c2cccc(CN3CCC4(CCNC4)C3)c2)nc1.
What is the InChIKey of 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The InChIKey is WZAOPAFMUJIXSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3.ClH/c1-2-9-21-18(6-1)17-5-3-4-16(12-17)13-22-11-8-19(15-22)7-10-20-14-19;/h1-6,9,12,20H,7-8,10-11,13-15H2;1H.
What are the key properties of 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride has a molecular weight of 329.88 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-pyridin-2-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride is sourced from PubChem (CID 120908518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).