About 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride
2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride (PubChem CID 120907721) has the molecular formula C17H23ClN4
and a molecular weight of 318.85 g/mol. Its IUPAC name is 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride.
Molecular Properties
| Compound Name | 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride |
| PubChem CID | 120907721 |
| Molecular Formula | C17H23ClN4 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride |
| SMILES | Cl.c1ccc(-c2[nH]ncc2CN2CCC3(CCNC3)C2)cc1 |
| InChI | InChI=1S/C17H22N4.ClH/c1-2-4-14(5-3-1)16-15(10-19-20-16)11-21-9-7-17(13-21)6-8-18-12-17;/h1-5,10,18H,6-9,11-13H2,(H,19,20);1H |
| InChIKey | VCEHDASIFRFNFK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The IUPAC name of 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride (CID 120907721) is 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride.
What is the SMILES notation for 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The canonical SMILES for 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride is Cl.c1ccc(-c2[nH]ncc2CN2CCC3(CCNC3)C2)cc1.
What is the InChIKey of 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
The InChIKey is VCEHDASIFRFNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4.ClH/c1-2-4-14(5-3-1)16-15(10-19-20-16)11-21-9-7-17(13-21)6-8-18-12-17;/h1-5,10,18H,6-9,11-13H2,(H,19,20);1H.
What are the key properties of 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride?
2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride has a molecular weight of 318.85 g/mol, XLogP of 2.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane;hydrochloride is sourced from PubChem (CID 120907721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).