C21H27N3O — CID 120906669
2-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decane (PubChem CID 120906669) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 120906669 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 2-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-2,8-diazaspiro[4.5]decane |
| SMILES | c1ccc(COc2cccc(CN3CCC4(CCNCC4)C3)c2)nc1 |
| InChI | InChI=1S/C21H27N3O/c1-2-10-23-19(5-1)16-25-20-6-3-4-18(14-20)15-24-13-9-21(17-24)7-11-22-12-8-21/h1-6,10,14,22H,7-9,11-13,15-17H2 |
| InChIKey | JNESMJJFLQQAMD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |