C18H21N3O3 — CID 56872361
4-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]piperazine-2-carboxylic acid (PubChem CID 56872361) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]piperazine-2-carboxylic acid.
| Compound Name | 4-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 56872361 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2cccc(OCc3ccccn3)c2)CCN1 |
| InChI | InChI=1S/C18H21N3O3/c22-18(23)17-12-21(9-8-20-17)11-14-4-3-6-16(10-14)24-13-15-5-1-2-7-19-15/h1-7,10,17,20H,8-9,11-13H2,(H,22,23) |
| InChIKey | ZMGVGGKGRCPNCQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |