C18H20N2O4 — CID 125438870
(2S)-4-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]morpholine-2-carboxylic acid (PubChem CID 125438870) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2S)-4-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]morpholine-2-carboxylic acid.
| Compound Name | (2S)-4-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 125438870 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2S)-4-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(Cc2cccc(OCc3ccccn3)c2)CCO1 |
| InChI | InChI=1S/C18H20N2O4/c21-18(22)17-12-20(8-9-23-17)11-14-4-3-6-16(10-14)24-13-15-5-1-2-7-19-15/h1-7,10,17H,8-9,11-13H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | FUCSRMKRHUSXHS-KRWDZBQOSA-N |
| XLogP | 1.95 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |