C18H28N2O — CID 120906573
2-[(3-propoxyphenyl)methyl]-2,8-diazaspiro[4.5]decane (PubChem CID 120906573) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-[(3-propoxyphenyl)methyl]-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-[(3-propoxyphenyl)methyl]-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 120906573 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-[(3-propoxyphenyl)methyl]-2,8-diazaspiro[4.5]decane |
| SMILES | CCCOc1cccc(CN2CCC3(CCNCC3)C2)c1 |
| InChI | InChI=1S/C18H28N2O/c1-2-12-21-17-5-3-4-16(13-17)14-20-11-8-18(15-20)6-9-19-10-7-18/h3-5,13,19H,2,6-12,14-15H2,1H3 |
| InChIKey | UGDPBKOQKMTWLN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |