C14H22Cl2N2 — CID 67386428
7-benzyl-2,7-diazaspiro[3.5]nonane;dihydrochloride (PubChem CID 67386428) has the molecular formula C14H22Cl2N2 and a molecular weight of 289.25 g/mol. Its IUPAC name is 7-benzyl-2,7-diazaspiro[3.5]nonane;dihydrochloride.
| Compound Name | 7-benzyl-2,7-diazaspiro[3.5]nonane;dihydrochloride |
|---|---|
| PubChem CID | 67386428 |
| Molecular Formula | C14H22Cl2N2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 7-benzyl-2,7-diazaspiro[3.5]nonane;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CN2CCC3(CC2)CNC3)cc1 |
| InChI | InChI=1S/C14H20N2.2ClH/c1-2-4-13(5-3-1)10-16-8-6-14(7-9-16)11-15-12-14;;/h1-5,15H,6-12H2;2*1H |
| InChIKey | OCNVLZCJFDMBME-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |