About azane;1-benzylpiperazine
azane;1-benzylpiperazine (PubChem CID 174866973) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is azane;1-benzylpiperazine.
Molecular Properties
| Compound Name | azane;1-benzylpiperazine |
| PubChem CID | 174866973 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | azane;1-benzylpiperazine |
| SMILES | N.c1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C11H16N2.H3N/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;/h1-5,12H,6-10H2;1H3 |
| InChIKey | LXZHEEFOANNNOQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;1-benzylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-benzylpiperazine?
The IUPAC name of azane;1-benzylpiperazine (CID 174866973) is azane;1-benzylpiperazine.
What is the SMILES notation for azane;1-benzylpiperazine?
The canonical SMILES for azane;1-benzylpiperazine is N.c1ccc(CN2CCNCC2)cc1.
What is the InChIKey of azane;1-benzylpiperazine?
The InChIKey is LXZHEEFOANNNOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.H3N/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;/h1-5,12H,6-10H2;1H3.
What are the key properties of azane;1-benzylpiperazine?
azane;1-benzylpiperazine has a molecular weight of 193.29 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-benzylpiperazine is sourced from PubChem (CID 174866973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).