C11H17N2P — CID 21334669
[4-(piperazin-1-ylmethyl)phenyl]phosphane (PubChem CID 21334669) has the molecular formula C11H17N2P and a molecular weight of 208.25 g/mol. Its IUPAC name is [4-(piperazin-1-ylmethyl)phenyl]phosphane.
| Compound Name | [4-(piperazin-1-ylmethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 21334669 |
| Molecular Formula | C11H17N2P |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | [4-(piperazin-1-ylmethyl)phenyl]phosphane |
| SMILES | Pc1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C11H17N2P/c14-11-3-1-10(2-4-11)9-13-7-5-12-6-8-13/h1-4,12H,5-9,14H2 |
| InChIKey | LNMXRBTUUAFZBN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|