C30H48N4 — CID 11328765
1,4-bis[(4-tert-butylphenyl)methyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 11328765) has the molecular formula C30H48N4 and a molecular weight of 464.74 g/mol. Its IUPAC name is 1,4-bis[(4-tert-butylphenyl)methyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4-bis[(4-tert-butylphenyl)methyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 11328765 |
| Molecular Formula | C30H48N4 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | 1,4-bis[(4-tert-butylphenyl)methyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | CC(C)(C)c1ccc(CN2CCNCCNCCN(Cc3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H48N4/c1-29(2,3)27-11-7-25(8-12-27)23-33-19-17-31-15-16-32-18-20-34(22-21-33)24-26-9-13-28(14-10-26)30(4,5)6/h7-14,31-32H,15-24H2,1-6H3 |
| InChIKey | SOTGVAPMKRKYLZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |