C16H26N2 — CID 117368978
1-[[4-(2,2-dimethylpropyl)phenyl]methyl]piperazine (PubChem CID 117368978) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-[[4-(2,2-dimethylpropyl)phenyl]methyl]piperazine.
| Compound Name | 1-[[4-(2,2-dimethylpropyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 117368978 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-[[4-(2,2-dimethylpropyl)phenyl]methyl]piperazine |
| SMILES | CC(C)(C)Cc1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C16H26N2/c1-16(2,3)12-14-4-6-15(7-5-14)13-18-10-8-17-9-11-18/h4-7,17H,8-13H2,1-3H3 |
| InChIKey | BWSFHBMJBCIWKL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |