C12H19N3 — CID 82162727
4-(1,4-diazepan-1-ylmethyl)aniline (PubChem CID 82162727) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-ylmethyl)aniline.
| Compound Name | 4-(1,4-diazepan-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 82162727 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4-(1,4-diazepan-1-ylmethyl)aniline |
| SMILES | Nc1ccc(CN2CCCNCC2)cc1 |
| InChI | InChI=1S/C12H19N3/c13-12-4-2-11(3-5-12)10-15-8-1-6-14-7-9-15/h2-5,14H,1,6-10,13H2 |
| InChIKey | MGVJHNZWZYPIGA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|