C17H31N5 — CID 11174238
4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)aniline (PubChem CID 11174238) has the molecular formula C17H31N5 and a molecular weight of 305.47 g/mol. Its IUPAC name is 4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)aniline.
| Compound Name | 4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 11174238 |
| Molecular Formula | C17H31N5 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | 4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)aniline |
| SMILES | Nc1ccc(CN2CCCNCCNCCCNCC2)cc1 |
| InChI | InChI=1S/C17H31N5/c18-17-5-3-16(4-6-17)15-22-13-2-9-20-11-10-19-7-1-8-21-12-14-22/h3-6,19-21H,1-2,7-15,18H2 |
| InChIKey | JFBWAJQPODZMRK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|