C27H53N9 — CID 11375545
4-[[6-(1,4,8,11-tetrazacyclotetradec-6-yl)-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]aniline (PubChem CID 11375545) has the molecular formula C27H53N9 and a molecular weight of 503.78 g/mol. Its IUPAC name is 4-[[6-(1,4,8,11-tetrazacyclotetradec-6-yl)-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]aniline.
| Compound Name | 4-[[6-(1,4,8,11-tetrazacyclotetradec-6-yl)-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 11375545 |
| Molecular Formula | C27H53N9 |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 503.44 |
| IUPAC Name | 4-[[6-(1,4,8,11-tetrazacyclotetradec-6-yl)-1,4,8,11-tetrazacyclotetradec-1-yl]methyl]aniline |
| SMILES | Nc1ccc(CN2CCCNCCNCC(C3CNCCNCCCNCCNC3)CNCC2)cc1 |
| InChI | InChI=1S/C27H53N9/c28-27-5-3-24(4-6-27)23-36-17-2-9-31-12-15-34-21-26(22-35-16-18-36)25-19-32-13-10-29-7-1-8-30-11-14-33-20-25/h3-6,25-26,29-35H,1-2,7-23,28H2 |
| InChIKey | AUCFHFVBRCOICX-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|