C16H29N5 — CID 71676639
1-(pyridin-4-ylmethyl)-1,4,8,11-tetrazacyclotetradecane (PubChem CID 71676639) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1-(pyridin-4-ylmethyl)-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 71676639 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-1,4,8,11-tetrazacyclotetradecane |
| SMILES | c1cc(CN2CCCNCCNCCCNCC2)ccn1 |
| InChI | InChI=1S/C16H29N5/c1-5-17-10-11-18-7-2-13-21(14-12-19-6-1)15-16-3-8-20-9-4-16/h3-4,8-9,17-19H,1-2,5-7,10-15H2 |
| InChIKey | CNGAEEPDZUVJOG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |