C27H51N9O2 — CID 11296475
1-[(4-nitrophenyl)methyl]-6-(1,4,8,11-tetrazacyclotetradec-6-yl)-1,4,8,11-tetrazacyclotetradecane (PubChem CID 11296475) has the molecular formula C27H51N9O2 and a molecular weight of 533.77 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methyl]-6-(1,4,8,11-tetrazacyclotetradec-6-yl)-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1-[(4-nitrophenyl)methyl]-6-(1,4,8,11-tetrazacyclotetradec-6-yl)-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 11296475 |
| Molecular Formula | C27H51N9O2 |
| Molecular Weight | 533.77 g/mol |
| Exact Mass | 533.42 |
| IUPAC Name | 1-[(4-nitrophenyl)methyl]-6-(1,4,8,11-tetrazacyclotetradec-6-yl)-1,4,8,11-tetrazacyclotetradecane |
| SMILES | O=[N+]([O-])c1ccc(CN2CCCNCCNCC(C3CNCCNCCCNCCNC3)CNCC2)cc1 |
| InChI | InChI=1S/C27H51N9O2/c37-36(38)27-5-3-24(4-6-27)23-35-17-2-9-30-12-15-33-21-26(22-34-16-18-35)25-19-31-13-10-28-7-1-8-29-11-14-32-20-25/h3-6,25-26,28-34H,1-2,7-23H2 |
| InChIKey | YRPANRCSSUPXGD-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.77 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|