C36H40N8O8 — CID 102293980
1,4,7,10-tetrakis[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane (PubChem CID 102293980) has the molecular formula C36H40N8O8 and a molecular weight of 712.76 g/mol. Its IUPAC name is 1,4,7,10-tetrakis[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetrakis[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 102293980 |
| Molecular Formula | C36H40N8O8 |
| Molecular Weight | 712.76 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | 1,4,7,10-tetrakis[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododecane |
| SMILES | O=[N+]([O-])c1ccc(CN2CCN(Cc3ccc([N+](=O)[O-])cc3)CCN(Cc3ccc([N+](=O)[O-])cc3)CCN(Cc3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C36H40N8O8/c45-41(46)33-9-1-29(2-10-33)25-37-17-19-38(26-30-3-11-34(12-4-30)42(47)48)21-23-40(28-32-7-15-36(16-8-32)44(51)52)24-22-39(20-18-37)27-31-5-13-35(14-6-31)43(49)50/h1-16H,17-28H2 |
| InChIKey | DSQLXESGHFKRDP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 185.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.76 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|