C15H23N3O2 — CID 126830526
N,N,4-trimethyl-1-[(4-nitrophenyl)methyl]piperidin-4-amine (PubChem CID 126830526) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N,N,4-trimethyl-1-[(4-nitrophenyl)methyl]piperidin-4-amine.
| Compound Name | N,N,4-trimethyl-1-[(4-nitrophenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 126830526 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N,N,4-trimethyl-1-[(4-nitrophenyl)methyl]piperidin-4-amine |
| SMILES | CN(C)C1(C)CCN(Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C15H23N3O2/c1-15(16(2)3)8-10-17(11-9-15)12-13-4-6-14(7-5-13)18(19)20/h4-7H,8-12H2,1-3H3 |
| InChIKey | HMMNMRFDJYPHDR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|