C18H32N5O4P — CID 59865435
(4-nitrophenyl)methyl-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phosphinic acid (PubChem CID 59865435) has the molecular formula C18H32N5O4P and a molecular weight of 413.46 g/mol. Its IUPAC name is (4-nitrophenyl)methyl-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phosphinic acid.
| Compound Name | (4-nitrophenyl)methyl-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phosphinic acid |
|---|---|
| PubChem CID | 59865435 |
| Molecular Formula | C18H32N5O4P |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (4-nitrophenyl)methyl-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phosphinic acid |
| SMILES | O=[N+]([O-])c1ccc(CP(=O)(O)CN2CCCNCCNCCCNCC2)cc1 |
| InChI | InChI=1S/C18H32N5O4P/c24-23(25)18-5-3-17(4-6-18)15-28(26,27)16-22-13-2-9-20-11-10-19-7-1-8-21-12-14-22/h3-6,19-21H,1-2,7-16H2,(H,26,27) |
| InChIKey | SBCZNNUASNJNNF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|