C13H18N4O3 — CID 62837178
2-(1,4-diazepan-1-yl)-N-(3-nitrophenyl)acetamide (PubChem CID 62837178) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 62837178 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCCNCC1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18N4O3/c18-13(10-16-7-2-5-14-6-8-16)15-11-3-1-4-12(9-11)17(19)20/h1,3-4,9,14H,2,5-8,10H2,(H,15,18) |
| InChIKey | ONGNRDIETKEYFH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|