C14H21N3O2 — CID 62838993
2-(1,4-diazepan-1-yl)-N-[3-(hydroxymethyl)phenyl]acetamide (PubChem CID 62838993) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-[3-(hydroxymethyl)phenyl]acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-[3-(hydroxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 62838993 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-[3-(hydroxymethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCCNCC1)Nc1cccc(CO)c1 |
| InChI | InChI=1S/C14H21N3O2/c18-11-12-3-1-4-13(9-12)16-14(19)10-17-7-2-5-15-6-8-17/h1,3-4,9,15,18H,2,5-8,10-11H2,(H,16,19) |
| InChIKey | DQMCAPIDKJBRGW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |