C17H24N4O2 — CID 119906484
N-cyclopropyl-3-[[2-(1,4-diazepan-1-yl)acetyl]amino]benzamide (PubChem CID 119906484) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-cyclopropyl-3-[[2-(1,4-diazepan-1-yl)acetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-3-[[2-(1,4-diazepan-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 119906484 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-cyclopropyl-3-[[2-(1,4-diazepan-1-yl)acetyl]amino]benzamide |
| SMILES | O=C(CN1CCCNCC1)Nc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C17H24N4O2/c22-16(12-21-9-2-7-18-8-10-21)19-15-4-1-3-13(11-15)17(23)20-14-5-6-14/h1,3-4,11,14,18H,2,5-10,12H2,(H,19,22)(H,20,23) |
| InChIKey | AFGSBOBVUDFDDH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |