C13H18IN3O — CID 54773502
2-(1,4-diazepan-1-yl)-N-(4-iodophenyl)acetamide (PubChem CID 54773502) has the molecular formula C13H18IN3O and a molecular weight of 359.21 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(4-iodophenyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 54773502 |
| Molecular Formula | C13H18IN3O |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CN1CCCNCC1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C13H18IN3O/c14-11-2-4-12(5-3-11)16-13(18)10-17-8-1-6-15-7-9-17/h2-5,15H,1,6-10H2,(H,16,18) |
| InChIKey | PFMNUZZKBXIALE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|