C20H26ClN3O2 — CID 119905944
2-(1,4-diazepan-1-yl)-N-(4-phenylmethoxyphenyl)acetamide;hydrochloride (PubChem CID 119905944) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(4-phenylmethoxyphenyl)acetamide;hydrochloride.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(4-phenylmethoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119905944 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(4-phenylmethoxyphenyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCCNCC1)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3O2.ClH/c24-20(15-23-13-4-11-21-12-14-23)22-18-7-9-19(10-8-18)25-16-17-5-2-1-3-6-17;/h1-3,5-10,21H,4,11-16H2,(H,22,24);1H |
| InChIKey | CWDABCCENFSCSI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |