C27H29FN4O2S — CID 3783930
N-(4-fluorophenyl)-2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 3783930) has the molecular formula C27H29FN4O2S and a molecular weight of 492.62 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 3783930 |
| Molecular Formula | C27H29FN4O2S |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | O=C(CN1CCCN(C(=S)Nc2ccc(OCc3ccccc3)cc2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H29FN4O2S/c28-22-7-9-23(10-8-22)29-26(33)19-31-15-4-16-32(18-17-31)27(35)30-24-11-13-25(14-12-24)34-20-21-5-2-1-3-6-21/h1-3,5-14H,4,15-20H2,(H,29,33)(H,30,35) |
| InChIKey | OCORTAHJSYVIOJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|