C24H24FN3O4 — CID 17439081
N-(4-fluorophenyl)-2-[4-[5-(phenoxymethyl)furan-2-carbonyl]piperazin-1-yl]acetamide (PubChem CID 17439081) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[5-(phenoxymethyl)furan-2-carbonyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[5-(phenoxymethyl)furan-2-carbonyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17439081 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[5-(phenoxymethyl)furan-2-carbonyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccc(COc3ccccc3)o2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FN3O4/c25-18-6-8-19(9-7-18)26-23(29)16-27-12-14-28(15-13-27)24(30)22-11-10-21(32-22)17-31-20-4-2-1-3-5-20/h1-11H,12-17H2,(H,26,29) |
| InChIKey | MZZSURLIGXCWFI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |