C28H29F3N4O2S — CID 3866117
2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 3866117) has the molecular formula C28H29F3N4O2S and a molecular weight of 542.63 g/mol. Its IUPAC name is 2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3866117 |
| Molecular Formula | C28H29F3N4O2S |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 2-[4-[(4-phenylmethoxyphenyl)carbamothioyl]-1,4-diazepan-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCCN(C(=S)Nc2ccc(OCc3ccccc3)cc2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H29F3N4O2S/c29-28(30,31)24-9-4-5-10-25(24)33-26(36)19-34-15-6-16-35(18-17-34)27(38)32-22-11-13-23(14-12-22)37-20-21-7-2-1-3-8-21/h1-5,7-14H,6,15-20H2,(H,32,38)(H,33,36) |
| InChIKey | QUVQUWFNMQTLTM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|