C22H24F3N3O2S — CID 3853393
benzyl 2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetate (PubChem CID 3853393) has the molecular formula C22H24F3N3O2S and a molecular weight of 451.51 g/mol. Its IUPAC name is benzyl 2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetate.
| Compound Name | benzyl 2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 3853393 |
| Molecular Formula | C22H24F3N3O2S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | benzyl 2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetate |
| SMILES | O=C(CN1CCCN(C(=S)Nc2ccccc2C(F)(F)F)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H24F3N3O2S/c23-22(24,25)18-9-4-5-10-19(18)26-21(31)28-12-6-11-27(13-14-28)15-20(29)30-16-17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2,(H,26,31) |
| InChIKey | QVUODNAGIXVNQY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|