C25H33N3O5S — CID 3672076
benzyl 2-[4-[(3,4,5-trimethoxyphenyl)methylcarbamothioyl]-1,4-diazepan-1-yl]acetate (PubChem CID 3672076) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is benzyl 2-[4-[(3,4,5-trimethoxyphenyl)methylcarbamothioyl]-1,4-diazepan-1-yl]acetate.
| Compound Name | benzyl 2-[4-[(3,4,5-trimethoxyphenyl)methylcarbamothioyl]-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 3672076 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | benzyl 2-[4-[(3,4,5-trimethoxyphenyl)methylcarbamothioyl]-1,4-diazepan-1-yl]acetate |
| SMILES | COc1cc(CNC(=S)N2CCCN(CC(=O)OCc3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C25H33N3O5S/c1-30-21-14-20(15-22(31-2)24(21)32-3)16-26-25(34)28-11-7-10-27(12-13-28)17-23(29)33-18-19-8-5-4-6-9-19/h4-6,8-9,14-15H,7,10-13,16-18H2,1-3H3,(H,26,34) |
| InChIKey | ZGYRQQXILRYOJU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|