C29H33N3O2S — CID 3592707
benzyl 2-[4-(2,2-diphenylethylcarbamothioyl)-1,4-diazepan-1-yl]acetate (PubChem CID 3592707) has the molecular formula C29H33N3O2S and a molecular weight of 487.67 g/mol. Its IUPAC name is benzyl 2-[4-(2,2-diphenylethylcarbamothioyl)-1,4-diazepan-1-yl]acetate.
| Compound Name | benzyl 2-[4-(2,2-diphenylethylcarbamothioyl)-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 3592707 |
| Molecular Formula | C29H33N3O2S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | benzyl 2-[4-(2,2-diphenylethylcarbamothioyl)-1,4-diazepan-1-yl]acetate |
| SMILES | O=C(CN1CCCN(C(=S)NCC(c2ccccc2)c2ccccc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C29H33N3O2S/c33-28(34-23-24-11-4-1-5-12-24)22-31-17-10-18-32(20-19-31)29(35)30-21-27(25-13-6-2-7-14-25)26-15-8-3-9-16-26/h1-9,11-16,27H,10,17-23H2,(H,30,35) |
| InChIKey | FEWQSBVAYPNVQD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|