C34H56N4O8 — CID 25179082
tritert-butyl 11-(2-oxo-2-phenylmethoxyethyl)-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate (PubChem CID 25179082) has the molecular formula C34H56N4O8 and a molecular weight of 648.84 g/mol. Its IUPAC name is tritert-butyl 11-(2-oxo-2-phenylmethoxyethyl)-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate.
| Compound Name | tritert-butyl 11-(2-oxo-2-phenylmethoxyethyl)-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate |
|---|---|
| PubChem CID | 25179082 |
| Molecular Formula | C34H56N4O8 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.41 |
| IUPAC Name | tritert-butyl 11-(2-oxo-2-phenylmethoxyethyl)-1,4,8,11-tetrazacyclotetradecane-1,4,8-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCCN(CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C34H56N4O8/c1-32(2,3)44-29(40)36-19-14-20-38(31(42)46-34(7,8)9)24-23-37(30(41)45-33(4,5)6)18-13-17-35(21-22-36)25-28(39)43-26-27-15-11-10-12-16-27/h10-12,15-16H,13-14,17-26H2,1-9H3 |
| InChIKey | UHQLDCDITMRODC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|