C29H39N3O6 — CID 153393655
tert-butyl 4-[2-[bis(2-oxo-2-phenylmethoxyethyl)amino]ethyl]piperazine-1-carboxylate (PubChem CID 153393655) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[bis(2-oxo-2-phenylmethoxyethyl)amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[bis(2-oxo-2-phenylmethoxyethyl)amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153393655 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | tert-butyl 4-[2-[bis(2-oxo-2-phenylmethoxyethyl)amino]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCN(CC(=O)OCc2ccccc2)CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H39N3O6/c1-29(2,3)38-28(35)32-18-16-30(17-19-32)14-15-31(20-26(33)36-22-24-10-6-4-7-11-24)21-27(34)37-23-25-12-8-5-9-13-25/h4-13H,14-23H2,1-3H3 |
| InChIKey | JNPRUEBSWCOXOI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|