C17H28N2O3 — CID 143725332
tert-butyl 4-benzylpiperazine-1-carboxylate;methanol (PubChem CID 143725332) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is tert-butyl 4-benzylpiperazine-1-carboxylate;methanol.
| Compound Name | tert-butyl 4-benzylpiperazine-1-carboxylate;methanol |
|---|---|
| PubChem CID | 143725332 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | tert-butyl 4-benzylpiperazine-1-carboxylate;methanol |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)CC1.CO |
| InChI | InChI=1S/C16H24N2O2.CH4O/c1-16(2,3)20-15(19)18-11-9-17(10-12-18)13-14-7-5-4-6-8-14;1-2/h4-8H,9-13H2,1-3H3;2H,1H3 |
| InChIKey | GWRACRXCZQJOJU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |