C18H29FN2O2 — CID 143091032
tert-butyl 4-[(4-fluorophenyl)methyl]piperazine-1-carboxylate;ethane (PubChem CID 143091032) has the molecular formula C18H29FN2O2 and a molecular weight of 324.44 g/mol. Its IUPAC name is tert-butyl 4-[(4-fluorophenyl)methyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[(4-fluorophenyl)methyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143091032 |
| Molecular Formula | C18H29FN2O2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | tert-butyl 4-[(4-fluorophenyl)methyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O2.C2H6/c1-16(2,3)21-15(20)19-10-8-18(9-11-19)12-13-4-6-14(17)7-5-13;1-2/h4-7H,8-12H2,1-3H3;1-2H3 |
| InChIKey | DDQXOWXJJQCPNL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |