C17H27N3O2 — CID 104933433
tert-butyl 4-[(4-aminophenyl)methyl]-1,4-diazepane-1-carboxylate (PubChem CID 104933433) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl 4-[(4-aminophenyl)methyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-aminophenyl)methyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 104933433 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | tert-butyl 4-[(4-aminophenyl)methyl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(Cc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C17H27N3O2/c1-17(2,3)22-16(21)20-10-4-9-19(11-12-20)13-14-5-7-15(18)8-6-14/h5-8H,4,9-13,18H2,1-3H3 |
| InChIKey | DHXVAWAKELXEBF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|