C14H23N5O2 — CID 122657592
tert-butyl 4-[(2-aminopyrimidin-5-yl)methyl]piperazine-1-carboxylate (PubChem CID 122657592) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is tert-butyl 4-[(2-aminopyrimidin-5-yl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-aminopyrimidin-5-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122657592 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | tert-butyl 4-[(2-aminopyrimidin-5-yl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cnc(N)nc2)CC1 |
| InChI | InChI=1S/C14H23N5O2/c1-14(2,3)21-13(20)19-6-4-18(5-7-19)10-11-8-16-12(15)17-9-11/h8-9H,4-7,10H2,1-3H3,(H2,15,16,17) |
| InChIKey | OQSDXKVAIPVSBO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |