C21H31N3O6 — CID 67475269
diethyl 4-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]pyridine-2,6-dicarboxylate (PubChem CID 67475269) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is diethyl 4-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]pyridine-2,6-dicarboxylate.
| Compound Name | diethyl 4-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 67475269 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | diethyl 4-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]pyridine-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(CN2CCN(C(=O)OC(C)(C)C)CC2)cc(C(=O)OCC)n1 |
| InChI | InChI=1S/C21H31N3O6/c1-6-28-18(25)16-12-15(13-17(22-16)19(26)29-7-2)14-23-8-10-24(11-9-23)20(27)30-21(3,4)5/h12-13H,6-11,14H2,1-5H3 |
| InChIKey | VZGBMRRJFUZFJZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|