C22H39N3O4 — CID 177246070
tert-butyl 4-(6-ethoxycarbonyl-2-methyl-3-pyridinyl)piperazine-1-carboxylate;ethane (PubChem CID 177246070) has the molecular formula C22H39N3O4 and a molecular weight of 409.57 g/mol. Its IUPAC name is tert-butyl 4-(6-ethoxycarbonyl-2-methyl-3-pyridinyl)piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(6-ethoxycarbonyl-2-methyl-3-pyridinyl)piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 177246070 |
| Molecular Formula | C22H39N3O4 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.29 |
| IUPAC Name | tert-butyl 4-(6-ethoxycarbonyl-2-methyl-3-pyridinyl)piperazine-1-carboxylate;ethane |
| SMILES | CC.CC.CCOC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(C)n1 |
| InChI | InChI=1S/C18H27N3O4.2C2H6/c1-6-24-16(22)14-7-8-15(13(2)19-14)20-9-11-21(12-10-20)17(23)25-18(3,4)5;2*1-2/h7-8H,6,9-12H2,1-5H3;2*1-2H3 |
| InChIKey | JOHTTXRIEMUNST-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |