C17H27N3O2 — CID 70581857
tert-butyl 4-(4-amino-2,3-dimethylphenyl)piperazine-1-carboxylate (PubChem CID 70581857) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-2,3-dimethylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-2,3-dimethylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70581857 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | tert-butyl 4-(4-amino-2,3-dimethylphenyl)piperazine-1-carboxylate |
| SMILES | Cc1c(N)ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C17H27N3O2/c1-12-13(2)15(7-6-14(12)18)19-8-10-20(11-9-19)16(21)22-17(3,4)5/h6-7H,8-11,18H2,1-5H3 |
| InChIKey | SRDUDNUJKZFVOV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|