C16H24FN3O2 — CID 86725408
tert-butyl 4-(4-amino-5-fluoro-2-methylphenyl)piperazine-1-carboxylate (PubChem CID 86725408) has the molecular formula C16H24FN3O2 and a molecular weight of 309.39 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-5-fluoro-2-methylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-5-fluoro-2-methylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86725408 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl 4-(4-amino-5-fluoro-2-methylphenyl)piperazine-1-carboxylate |
| SMILES | Cc1cc(N)c(F)cc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H24FN3O2/c1-11-9-13(18)12(17)10-14(11)19-5-7-20(8-6-19)15(21)22-16(2,3)4/h9-10H,5-8,18H2,1-4H3 |
| InChIKey | XPWHQNPCWNIYDE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|