C23H38N4O3 — CID 163939977
tert-butyl 4-[1-(4-amino-5-ethoxy-2-methylphenyl)piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 163939977) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-amino-5-ethoxy-2-methylphenyl)piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-amino-5-ethoxy-2-methylphenyl)piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163939977 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | tert-butyl 4-[1-(4-amino-5-ethoxy-2-methylphenyl)piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOc1cc(N2CCC(N3CCN(C(=O)OC(C)(C)C)CC3)CC2)c(C)cc1N |
| InChI | InChI=1S/C23H38N4O3/c1-6-29-21-16-20(17(2)15-19(21)24)26-9-7-18(8-10-26)25-11-13-27(14-12-25)22(28)30-23(3,4)5/h15-16,18H,6-14,24H2,1-5H3 |
| InChIKey | RQDSNHWPKLMUSB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|