C22H35N3O3 — CID 167272919
tert-butyl 9-(4-amino-5-methoxy-2-methylphenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 167272919) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is tert-butyl 9-(4-amino-5-methoxy-2-methylphenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-(4-amino-5-methoxy-2-methylphenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 167272919 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | tert-butyl 9-(4-amino-5-methoxy-2-methylphenyl)-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | COc1cc(N2CCC3(CCN(C(=O)OC(C)(C)C)CC3)CC2)c(C)cc1N |
| InChI | InChI=1S/C22H35N3O3/c1-16-14-17(23)19(27-5)15-18(16)24-10-6-22(7-11-24)8-12-25(13-9-22)20(26)28-21(2,3)4/h14-15H,6-13,23H2,1-5H3 |
| InChIKey | UZYRQTYFVYIYCT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|