C23H37N3O3 — CID 167273532
tert-butyl N-[7-(4-amino-2-ethyl-5-methoxyphenyl)-7-azaspiro[3.5]nonan-2-yl]-N-methylcarbamate (PubChem CID 167273532) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is tert-butyl N-[7-(4-amino-2-ethyl-5-methoxyphenyl)-7-azaspiro[3.5]nonan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[7-(4-amino-2-ethyl-5-methoxyphenyl)-7-azaspiro[3.5]nonan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 167273532 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | tert-butyl N-[7-(4-amino-2-ethyl-5-methoxyphenyl)-7-azaspiro[3.5]nonan-2-yl]-N-methylcarbamate |
| SMILES | CCc1cc(N)c(OC)cc1N1CCC2(CC1)CC(N(C)C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C23H37N3O3/c1-7-16-12-18(24)20(28-6)13-19(16)26-10-8-23(9-11-26)14-17(15-23)25(5)21(27)29-22(2,3)4/h12-13,17H,7-11,14-15,24H2,1-6H3 |
| InChIKey | QGDVLGHVLYJBLH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|