C23H36F2N4O3 — CID 172541462
tert-butyl 4-[1-[4-amino-5-(difluoromethoxy)-2-ethylphenyl]piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 172541462) has the molecular formula C23H36F2N4O3 and a molecular weight of 454.56 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-amino-5-(difluoromethoxy)-2-ethylphenyl]piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[4-amino-5-(difluoromethoxy)-2-ethylphenyl]piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 172541462 |
| Molecular Formula | C23H36F2N4O3 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | tert-butyl 4-[1-[4-amino-5-(difluoromethoxy)-2-ethylphenyl]piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCc1cc(N)c(OC(F)F)cc1N1CCC(N2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C23H36F2N4O3/c1-5-16-14-18(26)20(31-21(24)25)15-19(16)28-8-6-17(7-9-28)27-10-12-29(13-11-27)22(30)32-23(2,3)4/h14-15,17,21H,5-13,26H2,1-4H3 |
| InChIKey | MBNIYBSNNCJACB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|