C20H26F2N2O6 — CID 134582394
tert-butyl 4-[3-(difluoromethoxy)-4-ethoxycarbonyl-5-formylphenyl]piperazine-1-carboxylate (PubChem CID 134582394) has the molecular formula C20H26F2N2O6 and a molecular weight of 428.43 g/mol. Its IUPAC name is tert-butyl 4-[3-(difluoromethoxy)-4-ethoxycarbonyl-5-formylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(difluoromethoxy)-4-ethoxycarbonyl-5-formylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134582394 |
| Molecular Formula | C20H26F2N2O6 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | tert-butyl 4-[3-(difluoromethoxy)-4-ethoxycarbonyl-5-formylphenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)c1c(C=O)cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1OC(F)F |
| InChI | InChI=1S/C20H26F2N2O6/c1-5-28-17(26)16-13(12-25)10-14(11-15(16)29-18(21)22)23-6-8-24(9-7-23)19(27)30-20(2,3)4/h10-12,18H,5-9H2,1-4H3 |
| InChIKey | DXKVTEKQCHYOTL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|