C19H26N2O5 — CID 171508754
tert-butyl 4-(3-formyl-4-methoxycarbonylphenyl)-1,4-diazepane-1-carboxylate (PubChem CID 171508754) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is tert-butyl 4-(3-formyl-4-methoxycarbonylphenyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(3-formyl-4-methoxycarbonylphenyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 171508754 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | tert-butyl 4-(3-formyl-4-methoxycarbonylphenyl)-1,4-diazepane-1-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCCN(C(=O)OC(C)(C)C)CC2)cc1C=O |
| InChI | InChI=1S/C19H26N2O5/c1-19(2,3)26-18(24)21-9-5-8-20(10-11-21)15-6-7-16(17(23)25-4)14(12-15)13-22/h6-7,12-13H,5,8-11H2,1-4H3 |
| InChIKey | GJPVQJCSALKGNH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|