C18H29N3O2 — CID 69363807
tert-butyl 4-[4-(dimethylamino)phenyl]-1,4-diazepane-1-carboxylate (PubChem CID 69363807) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is tert-butyl 4-[4-(dimethylamino)phenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(dimethylamino)phenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 69363807 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | tert-butyl 4-[4-(dimethylamino)phenyl]-1,4-diazepane-1-carboxylate |
| SMILES | CN(C)c1ccc(N2CCCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H29N3O2/c1-18(2,3)23-17(22)21-12-6-11-20(13-14-21)16-9-7-15(8-10-16)19(4)5/h7-10H,6,11-14H2,1-5H3 |
| InChIKey | PRRKKHVBQNEJNI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|